C24H28FN5O5S2 — CID 4273857
6-[[2-[[5-[3-(dimethylsulfamoyl)phenyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hexanoic acid (PubChem CID 4273857) has the molecular formula C24H28FN5O5S2 and a molecular weight of 549.65 g/mol. Its IUPAC name is 6-[[2-[[5-[3-(dimethylsulfamoyl)phenyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[[5-[3-(dimethylsulfamoyl)phenyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 4273857 |
| Molecular Formula | C24H28FN5O5S2 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 6-[[2-[[5-[3-(dimethylsulfamoyl)phenyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hexanoic acid |
| SMILES | CN(C)S(=O)(=O)c1cccc(-c2nnc(SCC(=O)NCCCCCC(=O)O)n2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H28FN5O5S2/c1-29(2)37(34,35)20-8-6-7-17(15-20)23-27-28-24(30(23)19-12-10-18(25)11-13-19)36-16-21(31)26-14-5-3-4-9-22(32)33/h6-8,10-13,15H,3-5,9,14,16H2,1-2H3,(H,26,31)(H,32,33) |
| InChIKey | CKMDQIBLNGAZCI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|