C25H27N3O4 — CID 42741024
(4-butoxyphenyl)-[1-(4-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone (PubChem CID 42741024) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is (4-butoxyphenyl)-[1-(4-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone.
| Compound Name | (4-butoxyphenyl)-[1-(4-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone |
|---|---|
| PubChem CID | 42741024 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (4-butoxyphenyl)-[1-(4-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCCn3cccc3C2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H27N3O4/c1-2-3-18-32-22-13-9-20(10-14-22)25(29)27-17-5-16-26-15-4-6-23(26)24(27)19-7-11-21(12-8-19)28(30)31/h4,6-15,24H,2-3,5,16-18H2,1H3 |
| InChIKey | MCMYAEPSWHDYQS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|