C23H28N4O6 — CID 42742193
ethyl 4-(2,6-dimethylmorpholine-4-carbonyl)-2-(3-nitrophenyl)-6-propylpyrimidine-5-carboxylate (PubChem CID 42742193) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is ethyl 4-(2,6-dimethylmorpholine-4-carbonyl)-2-(3-nitrophenyl)-6-propylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(2,6-dimethylmorpholine-4-carbonyl)-2-(3-nitrophenyl)-6-propylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42742193 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | ethyl 4-(2,6-dimethylmorpholine-4-carbonyl)-2-(3-nitrophenyl)-6-propylpyrimidine-5-carboxylate |
| SMILES | CCCc1nc(-c2cccc([N+](=O)[O-])c2)nc(C(=O)N2CC(C)OC(C)C2)c1C(=O)OCC |
| InChI | InChI=1S/C23H28N4O6/c1-5-8-18-19(23(29)32-6-2)20(22(28)26-12-14(3)33-15(4)13-26)25-21(24-18)16-9-7-10-17(11-16)27(30)31/h7,9-11,14-15H,5-6,8,12-13H2,1-4H3 |
| InChIKey | WYWSRRYEKKFHNS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 124.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|