C19H10F5N3O2 — CID 4274346
2,3,4,5,6-pentafluoro-N-(2-pyridin-3-yl-2,3-dihydro-1,3-benzoxazol-5-yl)benzamide (PubChem CID 4274346) has the molecular formula C19H10F5N3O2 and a molecular weight of 407.30 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(2-pyridin-3-yl-2,3-dihydro-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(2-pyridin-3-yl-2,3-dihydro-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 4274346 |
| Molecular Formula | C19H10F5N3O2 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(2-pyridin-3-yl-2,3-dihydro-1,3-benzoxazol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)NC(c1cccnc1)O2)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H10F5N3O2/c20-13-12(14(21)16(23)17(24)15(13)22)18(28)26-9-3-4-11-10(6-9)27-19(29-11)8-2-1-5-25-7-8/h1-7,19,27H,(H,26,28) |
| InChIKey | ZZBOBXOPNUHCPV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|