About N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide
N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide (PubChem CID 42743619) has the molecular formula C22H24ClN3O3
and a molecular weight of 413.91 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide |
| PubChem CID | 42743619 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCCCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C22H24ClN3O3/c1-28-19-6-5-7-20(29-2)21(19)22(27)26-12-4-3-11-24-17-10-13-25-18-14-15(23)8-9-16(17)18/h5-10,13-14H,3-4,11-12H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | YWCGYSKGYPRBKG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide?
The IUPAC name of N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide (CID 42743619) is N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide.
What is the SMILES notation for N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide?
The canonical SMILES for N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide is COc1cccc(OC)c1C(=O)NCCCCNc1ccnc2cc(Cl)ccc12.
What is the InChIKey of N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide?
The InChIKey is YWCGYSKGYPRBKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24ClN3O3/c1-28-19-6-5-7-20(29-2)21(19)22(27)26-12-4-3-11-24-17-10-13-25-18-14-15(23)8-9-16(17)18/h5-10,13-14H,3-4,11-12H2,1-2H3,(H,24,25)(H,26,27).
What are the key properties of N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide?
N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide has a molecular weight of 413.91 g/mol, XLogP of 4.53, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(7-chloroquinolin-4-yl)amino]butyl]-2,6-dimethoxybenzamide is sourced from PubChem (CID 42743619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).