C21H22ClN3OS — CID 42743666
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-N-methyl-2-phenylsulfanylacetamide (PubChem CID 42743666) has the molecular formula C21H22ClN3OS and a molecular weight of 399.95 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-N-methyl-2-phenylsulfanylacetamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-N-methyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 42743666 |
| Molecular Formula | C21H22ClN3OS |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-N-methyl-2-phenylsulfanylacetamide |
| SMILES | CN(CCCNc1ccnc2cc(Cl)ccc12)C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C21H22ClN3OS/c1-25(21(26)15-27-17-6-3-2-4-7-17)13-5-11-23-19-10-12-24-20-14-16(22)8-9-18(19)20/h2-4,6-10,12,14H,5,11,13,15H2,1H3,(H,23,24) |
| InChIKey | IQYLLVMKPROSPM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|