C25H23FN2O2S — CID 42744425
3-(2-fluorobenzoyl)-2-phenyl-N-(1-phenylethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42744425) has the molecular formula C25H23FN2O2S and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-(2-fluorobenzoyl)-2-phenyl-N-(1-phenylethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(2-fluorobenzoyl)-2-phenyl-N-(1-phenylethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744425 |
| Molecular Formula | C25H23FN2O2S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-(2-fluorobenzoyl)-2-phenyl-N-(1-phenylethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CSC(c2ccccc2)N1C(=O)c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C25H23FN2O2S/c1-17(18-10-4-2-5-11-18)27-23(29)22-16-31-25(19-12-6-3-7-13-19)28(22)24(30)20-14-8-9-15-21(20)26/h2-15,17,22,25H,16H2,1H3,(H,27,29) |
| InChIKey | HCJONYNXQLWLRY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |