C23H29N3O3 — CID 42747286
N-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-2-phenylmethoxyacetamide (PubChem CID 42747286) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-2-phenylmethoxyacetamide.
| Compound Name | N-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 42747286 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-2-phenylmethoxyacetamide |
| SMILES | CN(C)c1ccc(NC(=O)COCc2ccccc2)cc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H29N3O3/c1-25(2)21-12-11-19(15-20(21)23(28)26-13-7-4-8-14-26)24-22(27)17-29-16-18-9-5-3-6-10-18/h3,5-6,9-12,15H,4,7-8,13-14,16-17H2,1-2H3,(H,24,27) |
| InChIKey | YIALDJFVKMIKGF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|