C26H25FN4O — CID 42750082
(4-benzylpiperazin-1-yl)-[6-fluoro-2-(1-methylpyrrol-2-yl)quinolin-4-yl]methanone (PubChem CID 42750082) has the molecular formula C26H25FN4O and a molecular weight of 428.51 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[6-fluoro-2-(1-methylpyrrol-2-yl)quinolin-4-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[6-fluoro-2-(1-methylpyrrol-2-yl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 42750082 |
| Molecular Formula | C26H25FN4O |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[6-fluoro-2-(1-methylpyrrol-2-yl)quinolin-4-yl]methanone |
| SMILES | Cn1cccc1-c1cc(C(=O)N2CCN(Cc3ccccc3)CC2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C26H25FN4O/c1-29-11-5-8-25(29)24-17-22(21-16-20(27)9-10-23(21)28-24)26(32)31-14-12-30(13-15-31)18-19-6-3-2-4-7-19/h2-11,16-17H,12-15,18H2,1H3 |
| InChIKey | DTIPNPDIRJWURS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |