C24H24ClN3O3 — CID 42754580
ethyl 1-[1-(4-chlorophenyl)-3-phenylpyrazole-5-carbonyl]piperidine-3-carboxylate (PubChem CID 42754580) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is ethyl 1-[1-(4-chlorophenyl)-3-phenylpyrazole-5-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(4-chlorophenyl)-3-phenylpyrazole-5-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42754580 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | ethyl 1-[1-(4-chlorophenyl)-3-phenylpyrazole-5-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cc(-c3ccccc3)nn2-c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H24ClN3O3/c1-2-31-24(30)18-9-6-14-27(16-18)23(29)22-15-21(17-7-4-3-5-8-17)26-28(22)20-12-10-19(25)11-13-20/h3-5,7-8,10-13,15,18H,2,6,9,14,16H2,1H3 |
| InChIKey | TYVBSMZWPWPJGS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |