C24H22N4O3 — CID 42755526
3-(3-methoxyphenyl)-1-(4-methoxyphenyl)-N-(pyridin-2-ylmethyl)pyrazole-5-carboxamide (PubChem CID 42755526) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-(4-methoxyphenyl)-N-(pyridin-2-ylmethyl)pyrazole-5-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-1-(4-methoxyphenyl)-N-(pyridin-2-ylmethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42755526 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-(4-methoxyphenyl)-N-(pyridin-2-ylmethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-n2nc(-c3cccc(OC)c3)cc2C(=O)NCc2ccccn2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-30-20-11-9-19(10-12-20)28-23(24(29)26-16-18-7-3-4-13-25-18)15-22(27-28)17-6-5-8-21(14-17)31-2/h3-15H,16H2,1-2H3,(H,26,29) |
| InChIKey | ZATYEPNEHCJPGY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |