C18H25N3O2 — CID 42758721
3-(3-methoxyphenyl)-1-methyl-N,N-dipropylpyrazole-5-carboxamide (PubChem CID 42758721) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-methyl-N,N-dipropylpyrazole-5-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-1-methyl-N,N-dipropylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42758721 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-methyl-N,N-dipropylpyrazole-5-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(-c2cccc(OC)c2)nn1C |
| InChI | InChI=1S/C18H25N3O2/c1-5-10-21(11-6-2)18(22)17-13-16(19-20(17)3)14-8-7-9-15(12-14)23-4/h7-9,12-13H,5-6,10-11H2,1-4H3 |
| InChIKey | OGVLQIPCIOGTJT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |