C9H7N3O2S — CID 4275980
4-(4-nitrophenyl)-1,3-dihydroimidazole-2-thione (PubChem CID 4275980) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(4-nitrophenyl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 4275980 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4-(4-nitrophenyl)-1,3-dihydroimidazole-2-thione |
| SMILES | O=[N+]([O-])c1ccc(-c2c[nH]c(=S)[nH]2)cc1 |
| InChI | InChI=1S/C9H7N3O2S/c13-12(14)7-3-1-6(2-4-7)8-5-10-9(15)11-8/h1-5H,(H2,10,11,15) |
| InChIKey | VTJUTVFOBSHNSS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|