C19H26N4O2 — CID 42760781
N-butyl-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxamide (PubChem CID 42760781) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-butyl-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxamide.
| Compound Name | N-butyl-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 42760781 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-butyl-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCCCC1c1nc(-c2cccc(C)c2)no1 |
| InChI | InChI=1S/C19H26N4O2/c1-3-4-11-20-19(24)23-12-6-5-10-16(23)18-21-17(22-25-18)15-9-7-8-14(2)13-15/h7-9,13,16H,3-6,10-12H2,1-2H3,(H,20,24) |
| InChIKey | BCZYLYLYSKYYRC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|