C19H14FN3O2S — CID 42761836
1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 42761836) has the molecular formula C19H14FN3O2S and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42761836 |
| Molecular Formula | C19H14FN3O2S |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cc(-c2cccs2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FN3O2S/c20-13-5-7-14(8-6-13)23-17(11-16(22-23)18-4-2-10-26-18)19(24)21-12-15-3-1-9-25-15/h1-11H,12H2,(H,21,24) |
| InChIKey | RTMJEDIKLCYNMN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |