C22H21N3O2 — CID 42765189
(E)-1-[2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 42765189) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is (E)-1-[2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 42765189 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (E)-1-[2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1cccc(-c2noc(C3CCCN3C(=O)/C=C/c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H21N3O2/c1-16-7-5-10-18(15-16)21-23-22(27-24-21)19-11-6-14-25(19)20(26)13-12-17-8-3-2-4-9-17/h2-5,7-10,12-13,15,19H,6,11,14H2,1H3/b13-12+ |
| InChIKey | NHNNAIBIVGEZQU-OUKQBFOZSA-N |
| XLogP | 4.42 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|