About 1,3-dicyclohexylurea
1,3-dicyclohexylurea (PubChem CID 4277) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1,3-dicyclohexylurea.
Molecular Properties
| Compound Name | 1,3-dicyclohexylurea |
| PubChem CID | 4277 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1,3-dicyclohexylurea |
| SMILES | O=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16) |
| InChIKey | ADFXKUOMJKEIND-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dicyclohexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclohexylurea?
The IUPAC name of 1,3-dicyclohexylurea (CID 4277) is 1,3-dicyclohexylurea.
What is the SMILES notation for 1,3-dicyclohexylurea?
The canonical SMILES for 1,3-dicyclohexylurea is O=C(NC1CCCCC1)NC1CCCCC1.
What is the InChIKey of 1,3-dicyclohexylurea?
The InChIKey is ADFXKUOMJKEIND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16).
What are the key properties of 1,3-dicyclohexylurea?
1,3-dicyclohexylurea has a molecular weight of 224.35 g/mol, XLogP of 2.95, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclohexylurea is sourced from PubChem (CID 4277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).