C15H22ClN3O3 — CID 42770361
2-[(2-chloroacetyl)-(cyclohexylmethyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 42770361) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(cyclohexylmethyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-(cyclohexylmethyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42770361 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[(2-chloroacetyl)-(cyclohexylmethyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN(CC2CCCCC2)C(=O)CCl)no1 |
| InChI | InChI=1S/C15H22ClN3O3/c1-11-7-13(18-22-11)17-14(20)10-19(15(21)8-16)9-12-5-3-2-4-6-12/h7,12H,2-6,8-10H2,1H3,(H,17,18,20) |
| InChIKey | KSVYNEOQKQVZGN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|