C20H21ClFN5O2 — CID 4277076
3-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 4277076) has the molecular formula C20H21ClFN5O2 and a molecular weight of 417.87 g/mol. Its IUPAC name is 3-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 4277076 |
| Molecular Formula | C20H21ClFN5O2 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(Cl)c1C=NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C20H21ClFN5O2/c1-13-16(17(21)26(25-13)12-14-5-7-15(22)8-6-14)11-23-27-18(28)20(24-19(27)29)9-3-2-4-10-20/h5-8,11H,2-4,9-10,12H2,1H3,(H,24,29) |
| InChIKey | SHBQEVYKPYMRML-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|