C30H32N6O5 — CID 42771117
3-[2-(3,4-dimethylanilino)-2-oxoethyl]-N-(4-nitrophenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide (PubChem CID 42771117) has the molecular formula C30H32N6O5 and a molecular weight of 556.62 g/mol. Its IUPAC name is 3-[2-(3,4-dimethylanilino)-2-oxoethyl]-N-(4-nitrophenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide.
| Compound Name | 3-[2-(3,4-dimethylanilino)-2-oxoethyl]-N-(4-nitrophenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 42771117 |
| Molecular Formula | C30H32N6O5 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 3-[2-(3,4-dimethylanilino)-2-oxoethyl]-N-(4-nitrophenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| SMILES | Cc1ccc(NC(=O)CN2CN(c3ccccc3)C3(CCN(C(=O)Nc4ccc([N+](=O)[O-])cc4)CC3)C2=O)cc1C |
| InChI | InChI=1S/C30H32N6O5/c1-21-8-9-24(18-22(21)2)31-27(37)19-34-20-35(25-6-4-3-5-7-25)30(28(34)38)14-16-33(17-15-30)29(39)32-23-10-12-26(13-11-23)36(40)41/h3-13,18H,14-17,19-20H2,1-2H3,(H,31,37)(H,32,39) |
| InChIKey | MXNZGGXNEUBQEY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|