About 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one
3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one (PubChem CID 4277346) has the molecular formula C19H17Cl2N3O3
and a molecular weight of 406.27 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one |
| PubChem CID | 4277346 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one |
| SMILES | O=C1Nc2ccccc2C(O)(C(=O)N2CCCC2)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N3O3/c20-14-8-7-12(11-15(14)21)24-18(26)22-16-6-2-1-5-13(16)19(24,27)17(25)23-9-3-4-10-23/h1-2,5-8,11,27H,3-4,9-10H2,(H,22,26) |
| InChIKey | LXYPFJMSLAPGNU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one?
The IUPAC name of 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one (CID 4277346) is 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one?
The canonical SMILES for 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one is O=C1Nc2ccccc2C(O)(C(=O)N2CCCC2)N1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one?
The InChIKey is LXYPFJMSLAPGNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2N3O3/c20-14-8-7-12(11-15(14)21)24-18(26)22-16-6-2-1-5-13(16)19(24,27)17(25)23-9-3-4-10-23/h1-2,5-8,11,27H,3-4,9-10H2,(H,22,26).
What are the key properties of 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one?
3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one has a molecular weight of 406.27 g/mol, XLogP of 3.81, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-4-hydroxy-4-(pyrrolidine-1-carbonyl)-1H-quinazolin-2-one is sourced from PubChem (CID 4277346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).