C21H23ClN2O2S — CID 42773761
N-[2-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-prop-2-enylpropanamide (PubChem CID 42773761) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is N-[2-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-prop-2-enylpropanamide.
| Compound Name | N-[2-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 42773761 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[2-[4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCN(CC(=O)N1CCc2sccc2C1c1ccc(Cl)cc1)C(=O)CC |
| InChI | InChI=1S/C21H23ClN2O2S/c1-3-11-23(19(25)4-2)14-20(26)24-12-9-18-17(10-13-27-18)21(24)15-5-7-16(22)8-6-15/h3,5-8,10,13,21H,1,4,9,11-12,14H2,2H3 |
| InChIKey | CYEDANWZSBVIRC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|