C20H27ClN2O2S — CID 42774047
3-chloro-2,2-dimethyl-1-[4-(3-methylbenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]propan-1-one (PubChem CID 42774047) has the molecular formula C20H27ClN2O2S and a molecular weight of 394.97 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-1-[4-(3-methylbenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]propan-1-one.
| Compound Name | 3-chloro-2,2-dimethyl-1-[4-(3-methylbenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]propan-1-one |
|---|---|
| PubChem CID | 42774047 |
| Molecular Formula | C20H27ClN2O2S |
| Molecular Weight | 394.97 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-chloro-2,2-dimethyl-1-[4-(3-methylbenzoyl)-1-thia-4,8-diazaspiro[4.5]decan-8-yl]propan-1-one |
| SMILES | Cc1cccc(C(=O)N2CCSC23CCN(C(=O)C(C)(C)CCl)CC3)c1 |
| InChI | InChI=1S/C20H27ClN2O2S/c1-15-5-4-6-16(13-15)17(24)23-11-12-26-20(23)7-9-22(10-8-20)18(25)19(2,3)14-21/h4-6,13H,7-12,14H2,1-3H3 |
| InChIKey | IGQDEKCZMQIWCM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.97 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|