C28H31N3OS — CID 42774929
3-(1-benzylindol-3-yl)-1-(4-ethylpiperazin-1-yl)-3-thiophen-2-ylpropan-1-one (PubChem CID 42774929) has the molecular formula C28H31N3OS and a molecular weight of 457.64 g/mol. Its IUPAC name is 3-(1-benzylindol-3-yl)-1-(4-ethylpiperazin-1-yl)-3-thiophen-2-ylpropan-1-one.
| Compound Name | 3-(1-benzylindol-3-yl)-1-(4-ethylpiperazin-1-yl)-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 42774929 |
| Molecular Formula | C28H31N3OS |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 3-(1-benzylindol-3-yl)-1-(4-ethylpiperazin-1-yl)-3-thiophen-2-ylpropan-1-one |
| SMILES | CCN1CCN(C(=O)CC(c2cccs2)c2cn(Cc3ccccc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C28H31N3OS/c1-2-29-14-16-30(17-15-29)28(32)19-24(27-13-8-18-33-27)25-21-31(20-22-9-4-3-5-10-22)26-12-7-6-11-23(25)26/h3-13,18,21,24H,2,14-17,19-20H2,1H3 |
| InChIKey | MAXHQWARPNIONW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |