C29H28N2O3 — CID 42779867
N-[3-(benzhydrylamino)-3-oxopropyl]-N-benzyl-2-methylfuran-3-carboxamide (PubChem CID 42779867) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is N-[3-(benzhydrylamino)-3-oxopropyl]-N-benzyl-2-methylfuran-3-carboxamide.
| Compound Name | N-[3-(benzhydrylamino)-3-oxopropyl]-N-benzyl-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 42779867 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[3-(benzhydrylamino)-3-oxopropyl]-N-benzyl-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N(CCC(=O)NC(c1ccccc1)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H28N2O3/c1-22-26(18-20-34-22)29(33)31(21-23-11-5-2-6-12-23)19-17-27(32)30-28(24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-16,18,20,28H,17,19,21H2,1H3,(H,30,32) |
| InChIKey | GMDORSIXFVQFNY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |