C17H18BrNO3 — CID 4277992
(2-bromo-4,5-dimethylphenyl) N-(4-ethoxyphenyl)carbamate (PubChem CID 4277992) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is (2-bromo-4,5-dimethylphenyl) N-(4-ethoxyphenyl)carbamate.
| Compound Name | (2-bromo-4,5-dimethylphenyl) N-(4-ethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 4277992 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (2-bromo-4,5-dimethylphenyl) N-(4-ethoxyphenyl)carbamate |
| SMILES | CCOc1ccc(NC(=O)Oc2cc(C)c(C)cc2Br)cc1 |
| InChI | InChI=1S/C17H18BrNO3/c1-4-21-14-7-5-13(6-8-14)19-17(20)22-16-10-12(3)11(2)9-15(16)18/h5-10H,4H2,1-3H3,(H,19,20) |
| InChIKey | DETWXKGGUSCSAH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |