About ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate
ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate (PubChem CID 42782284) has the molecular formula C22H29NO4
and a molecular weight of 371.48 g/mol. Its IUPAC name is ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate |
| PubChem CID | 42782284 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1CN(C(=O)c1cccc2c1OCC2)C1CCCCC1 |
| InChI | InChI=1S/C22H29NO4/c1-2-26-22(25)19-13-16(19)14-23(17-8-4-3-5-9-17)21(24)18-10-6-7-15-11-12-27-20(15)18/h6-7,10,16-17,19H,2-5,8-9,11-14H2,1H3 |
| InChIKey | VYSFTKLDMPGLRO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate?
The IUPAC name of ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate (CID 42782284) is ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate is CCOC(=O)C1CC1CN(C(=O)c1cccc2c1OCC2)C1CCCCC1.
What is the InChIKey of ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate?
The InChIKey is VYSFTKLDMPGLRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO4/c1-2-26-22(25)19-13-16(19)14-23(17-8-4-3-5-9-17)21(24)18-10-6-7-15-11-12-27-20(15)18/h6-7,10,16-17,19H,2-5,8-9,11-14H2,1H3.
What are the key properties of ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate?
ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate has a molecular weight of 371.48 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[cyclohexyl(2,3-dihydro-1-benzofuran-7-carbonyl)amino]methyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 42782284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).