C12H12N2O2S — CID 4278270
3-amino-5-(4-methoxyphenyl)thiophene-2-carboxamide (PubChem CID 4278270) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4278270 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-amino-5-(4-methoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(N)c(C(N)=O)s2)cc1 |
| InChI | InChI=1S/C12H12N2O2S/c1-16-8-4-2-7(3-5-8)10-6-9(13)11(17-10)12(14)15/h2-6H,13H2,1H3,(H2,14,15) |
| InChIKey | OEUITKOCUWEFOB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |