About N-benzyl-N,2-dimethylpropanamide
N-benzyl-N,2-dimethylpropanamide (PubChem CID 4278282) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is N-benzyl-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-benzyl-N,2-dimethylpropanamide |
| PubChem CID | 4278282 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-benzyl-N,2-dimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO/c1-10(2)12(14)13(3)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3 |
| InChIKey | JQIZZLMVZXJJJC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N,2-dimethylpropanamide?
The IUPAC name of N-benzyl-N,2-dimethylpropanamide (CID 4278282) is N-benzyl-N,2-dimethylpropanamide.
What is the SMILES notation for N-benzyl-N,2-dimethylpropanamide?
The canonical SMILES for N-benzyl-N,2-dimethylpropanamide is CC(C)C(=O)N(C)Cc1ccccc1.
What is the InChIKey of N-benzyl-N,2-dimethylpropanamide?
The InChIKey is JQIZZLMVZXJJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-10(2)12(14)13(3)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3.
What are the key properties of N-benzyl-N,2-dimethylpropanamide?
N-benzyl-N,2-dimethylpropanamide has a molecular weight of 191.27 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N,2-dimethylpropanamide is sourced from PubChem (CID 4278282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).