C23H27ClN2O3 — CID 42785260
3-chloro-N-[3-[5-(cyclobutanecarbonyl)-6,7-dihydro-4H-furo[3,2-c]pyridin-2-yl]phenyl]-2,2-dimethylpropanamide (PubChem CID 42785260) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is 3-chloro-N-[3-[5-(cyclobutanecarbonyl)-6,7-dihydro-4H-furo[3,2-c]pyridin-2-yl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[3-[5-(cyclobutanecarbonyl)-6,7-dihydro-4H-furo[3,2-c]pyridin-2-yl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42785260 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-chloro-N-[3-[5-(cyclobutanecarbonyl)-6,7-dihydro-4H-furo[3,2-c]pyridin-2-yl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1cccc(-c2cc3c(o2)CCN(C(=O)C2CCC2)C3)c1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-23(2,14-24)22(28)25-18-8-4-7-16(11-18)20-12-17-13-26(10-9-19(17)29-20)21(27)15-5-3-6-15/h4,7-8,11-12,15H,3,5-6,9-10,13-14H2,1-2H3,(H,25,28) |
| InChIKey | JOZVULDQVYGXRK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|