C24H40N2O2S — CID 4278594
2-(decanoylamino)-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4278594) has the molecular formula C24H40N2O2S and a molecular weight of 420.66 g/mol. Its IUPAC name is 2-(decanoylamino)-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-(decanoylamino)-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4278594 |
| Molecular Formula | C24H40N2O2S |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 2-(decanoylamino)-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCCCCCCCC(=O)Nc1sc2c(c1C(N)=O)CCC(C(C)(C)CC)C2 |
| InChI | InChI=1S/C24H40N2O2S/c1-5-7-8-9-10-11-12-13-20(27)26-23-21(22(25)28)18-15-14-17(16-19(18)29-23)24(3,4)6-2/h17H,5-16H2,1-4H3,(H2,25,28)(H,26,27) |
| InChIKey | ICYSAXILHKMLRX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|