C22H36N4O2 — CID 42786464
1-[4-(2,6-dimethylmorpholin-4-yl)-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]octan-1-one (PubChem CID 42786464) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[4-(2,6-dimethylmorpholin-4-yl)-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]octan-1-one.
| Compound Name | 1-[4-(2,6-dimethylmorpholin-4-yl)-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]octan-1-one |
|---|---|
| PubChem CID | 42786464 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 1-[4-(2,6-dimethylmorpholin-4-yl)-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCc2nc(C)nc(N3CC(C)OC(C)C3)c2C1 |
| InChI | InChI=1S/C22H36N4O2/c1-5-6-7-8-9-10-21(27)25-12-11-20-19(15-25)22(24-18(4)23-20)26-13-16(2)28-17(3)14-26/h16-17H,5-15H2,1-4H3 |
| InChIKey | FQSVYBUPOBOUBZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|