About Audouine
Audouine (PubChem CID 42788) has the molecular formula C7H18N6
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-[5-(diaminomethylideneamino)pentyl]guanidine.
Molecular Properties
| Compound Name | Audouine |
| PubChem CID | 42788 |
| Molecular Formula | C7H18N6 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-[5-(diaminomethylideneamino)pentyl]guanidine |
| SMILES | C(CCN=C(N)N)CCN=C(N)N |
| InChI | InChI=1S/C7H18N6/c8-6(9)12-4-2-1-3-5-13-7(10)11/h1-5H2,(H4,8,9,12)(H4,10,11,13) |
| InChIKey | FIHKQNOFFQZHRM-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | 157 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze Audouine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Audouine?
The IUPAC name of Audouine (CID 42788) is 2-[5-(diaminomethylideneamino)pentyl]guanidine.
What is the SMILES notation for Audouine?
The canonical SMILES for Audouine is C(CCN=C(N)N)CCN=C(N)N.
What is the InChIKey of Audouine?
The InChIKey is FIHKQNOFFQZHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N6/c8-6(9)12-4-2-1-3-5-13-7(10)11/h1-5H2,(H4,8,9,12)(H4,10,11,13).
What are the key properties of Audouine?
Audouine has a molecular weight of 186.26 g/mol, XLogP of -1.80, 6 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Audouine is sourced from PubChem (CID 42788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).