C20H25N3O3 — CID 42789284
6-ethoxy-4-(4-propan-2-ylphenyl)-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 42789284) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 6-ethoxy-4-(4-propan-2-ylphenyl)-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | 6-ethoxy-4-(4-propan-2-ylphenyl)-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 42789284 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 6-ethoxy-4-(4-propan-2-ylphenyl)-1-prop-2-enyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | C=CCN1C(=O)NC(c2ccc(C(C)C)cc2)C2=C1CN(OCC)C2=O |
| InChI | InChI=1S/C20H25N3O3/c1-5-11-22-16-12-23(26-6-2)19(24)17(16)18(21-20(22)25)15-9-7-14(8-10-15)13(3)4/h5,7-10,13,18H,1,6,11-12H2,2-4H3,(H,21,25) |
| InChIKey | ZVOHXFPTMZWQMA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|