C21H21FN2O2 — CID 42789889
3-fluoro-N-[[3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-prop-2-enylbenzamide (PubChem CID 42789889) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-fluoro-N-[[3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 3-fluoro-N-[[3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42789889 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-fluoro-N-[[3-(4-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC1CC(c2ccc(C)cc2)=NO1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H21FN2O2/c1-3-11-24(21(25)17-5-4-6-18(22)12-17)14-19-13-20(23-26-19)16-9-7-15(2)8-10-16/h3-10,12,19H,1,11,13-14H2,2H3 |
| InChIKey | OZBCZRDWVRPWOA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|