About [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol
[2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol (PubChem CID 42795286) has the molecular formula C14H12F2N2OS
and a molecular weight of 294.33 g/mol. Its IUPAC name is [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol |
| PubChem CID | 42795286 |
| Molecular Formula | C14H12F2N2OS |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol |
| SMILES | C#CCn1c(CO)cnc1SCc1c(F)cccc1F |
| InChI | InChI=1S/C14H12F2N2OS/c1-2-6-18-10(8-19)7-17-14(18)20-9-11-12(15)4-3-5-13(11)16/h1,3-5,7,19H,6,8-9H2 |
| InChIKey | BHTANGUWRZMYTM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol?
The IUPAC name of [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol (CID 42795286) is [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol.
What is the SMILES notation for [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol?
The canonical SMILES for [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol is C#CCn1c(CO)cnc1SCc1c(F)cccc1F.
What is the InChIKey of [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol?
The InChIKey is BHTANGUWRZMYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2OS/c1-2-6-18-10(8-19)7-17-14(18)20-9-11-12(15)4-3-5-13(11)16/h1,3-5,7,19H,6,8-9H2.
What are the key properties of [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol?
[2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol has a molecular weight of 294.33 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,6-difluorophenyl)methylsulfanyl]-3-prop-2-ynylimidazol-4-yl]methanol is sourced from PubChem (CID 42795286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).