C21H22N4O3S2 — CID 42795630
4-[3-(2-oxopyrrolidin-1-yl)propyl]-11-(thiophene-2-carbonyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 42795630) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 4-[3-(2-oxopyrrolidin-1-yl)propyl]-11-(thiophene-2-carbonyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[3-(2-oxopyrrolidin-1-yl)propyl]-11-(thiophene-2-carbonyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 42795630 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-[3-(2-oxopyrrolidin-1-yl)propyl]-11-(thiophene-2-carbonyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | O=C1CCCN1CCCn1cnc2sc3c(c2c1=O)CCN(C(=O)c1cccs1)C3 |
| InChI | InChI=1S/C21H22N4O3S2/c26-17-5-1-7-23(17)8-3-9-25-13-22-19-18(21(25)28)14-6-10-24(12-16(14)30-19)20(27)15-4-2-11-29-15/h2,4,11,13H,1,3,5-10,12H2 |
| InChIKey | QZUGHFQBKJHAQA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |