C18H28N4 — CID 42795776
N',N'-dimethyl-N-[[1-[(2,4,6-trimethylphenyl)methyl]imidazol-2-yl]methyl]ethane-1,2-diamine (PubChem CID 42795776) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[1-[(2,4,6-trimethylphenyl)methyl]imidazol-2-yl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[[1-[(2,4,6-trimethylphenyl)methyl]imidazol-2-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 42795776 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | N',N'-dimethyl-N-[[1-[(2,4,6-trimethylphenyl)methyl]imidazol-2-yl]methyl]ethane-1,2-diamine |
| SMILES | Cc1cc(C)c(Cn2ccnc2CNCCN(C)C)c(C)c1 |
| InChI | InChI=1S/C18H28N4/c1-14-10-15(2)17(16(3)11-14)13-22-9-7-20-18(22)12-19-6-8-21(4)5/h7,9-11,19H,6,8,12-13H2,1-5H3 |
| InChIKey | DRLFDQUAMJNJQQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|