C23H23N5O — CID 42796388
N-(1H-imidazol-5-ylmethyl)-N-(4-phenylbutan-2-yl)quinoxaline-6-carboxamide (PubChem CID 42796388) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-N-(4-phenylbutan-2-yl)quinoxaline-6-carboxamide.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-N-(4-phenylbutan-2-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 42796388 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-N-(4-phenylbutan-2-yl)quinoxaline-6-carboxamide |
| SMILES | CC(CCc1ccccc1)N(Cc1cnc[nH]1)C(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C23H23N5O/c1-17(7-8-18-5-3-2-4-6-18)28(15-20-14-24-16-27-20)23(29)19-9-10-21-22(13-19)26-12-11-25-21/h2-6,9-14,16-17H,7-8,15H2,1H3,(H,24,27) |
| InChIKey | BYKPBRVSUZYOOA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |