C25H34FN3O2 — CID 42798001
N-tert-butyl-N-[2-[1-(3-fluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-oxoethyl]hexanamide (PubChem CID 42798001) has the molecular formula C25H34FN3O2 and a molecular weight of 427.56 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[1-(3-fluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-oxoethyl]hexanamide.
| Compound Name | N-tert-butyl-N-[2-[1-(3-fluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 42798001 |
| Molecular Formula | C25H34FN3O2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N-tert-butyl-N-[2-[1-(3-fluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-oxoethyl]hexanamide |
| SMILES | CCCCCC(=O)N(CC(=O)N1CCn2cccc2C1c1cccc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C25H34FN3O2/c1-5-6-7-13-22(30)29(25(2,3)4)18-23(31)28-16-15-27-14-9-12-21(27)24(28)19-10-8-11-20(26)17-19/h8-12,14,17,24H,5-7,13,15-16,18H2,1-4H3 |
| InChIKey | RNCMPFXPRMQTDL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|