C30H28N4O5S — CID 42798996
2-[4-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)-7-oxo-3-phenyl-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-ethoxyacetamide (PubChem CID 42798996) has the molecular formula C30H28N4O5S and a molecular weight of 556.64 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)-7-oxo-3-phenyl-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-ethoxyacetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)-7-oxo-3-phenyl-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-ethoxyacetamide |
|---|---|
| PubChem CID | 42798996 |
| Molecular Formula | C30H28N4O5S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)-7-oxo-3-phenyl-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-ethoxyacetamide |
| SMILES | CCONC(=O)CN1C(=O)CSC(c2ccc3c(c2)OCO3)c2c(-c3ccccc3)nn(-c3ccc(C)cc3)c21 |
| InChI | InChI=1S/C30H28N4O5S/c1-3-39-32-25(35)16-33-26(36)17-40-29(21-11-14-23-24(15-21)38-18-37-23)27-28(20-7-5-4-6-8-20)31-34(30(27)33)22-12-9-19(2)10-13-22/h4-15,29H,3,16-18H2,1-2H3,(H,32,35) |
| InChIKey | UUWWDVXEEQVSAD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|