C25H30N4O3S2 — CID 42799146
2-[3-tert-butyl-1-(4-methylphenyl)-7-oxo-4-thiophen-2-yl-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-ethoxyacetamide (PubChem CID 42799146) has the molecular formula C25H30N4O3S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is 2-[3-tert-butyl-1-(4-methylphenyl)-7-oxo-4-thiophen-2-yl-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-ethoxyacetamide.
| Compound Name | 2-[3-tert-butyl-1-(4-methylphenyl)-7-oxo-4-thiophen-2-yl-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-ethoxyacetamide |
|---|---|
| PubChem CID | 42799146 |
| Molecular Formula | C25H30N4O3S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-[3-tert-butyl-1-(4-methylphenyl)-7-oxo-4-thiophen-2-yl-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-ethoxyacetamide |
| SMILES | CCONC(=O)CN1C(=O)CSC(c2cccs2)c2c(C(C)(C)C)nn(-c3ccc(C)cc3)c21 |
| InChI | InChI=1S/C25H30N4O3S2/c1-6-32-27-19(30)14-28-20(31)15-34-22(18-8-7-13-33-18)21-23(25(3,4)5)26-29(24(21)28)17-11-9-16(2)10-12-17/h7-13,22H,6,14-15H2,1-5H3,(H,27,30) |
| InChIKey | JXAORAHIXZMHIA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|