C30H37ClN4O2S — CID 42799213
2-[3-tert-butyl-4-(2-chlorophenyl)-1-(2-methylphenyl)-7-oxo-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-pentylacetamide (PubChem CID 42799213) has the molecular formula C30H37ClN4O2S and a molecular weight of 553.17 g/mol. Its IUPAC name is 2-[3-tert-butyl-4-(2-chlorophenyl)-1-(2-methylphenyl)-7-oxo-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-pentylacetamide.
| Compound Name | 2-[3-tert-butyl-4-(2-chlorophenyl)-1-(2-methylphenyl)-7-oxo-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-pentylacetamide |
|---|---|
| PubChem CID | 42799213 |
| Molecular Formula | C30H37ClN4O2S |
| Molecular Weight | 553.17 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 2-[3-tert-butyl-4-(2-chlorophenyl)-1-(2-methylphenyl)-7-oxo-4H-pyrazolo[5,4-e][1,4]thiazepin-8-yl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN1C(=O)CSC(c2ccccc2Cl)c2c(C(C)(C)C)nn(-c3ccccc3C)c21 |
| InChI | InChI=1S/C30H37ClN4O2S/c1-6-7-12-17-32-24(36)18-34-25(37)19-38-27(21-14-9-10-15-22(21)31)26-28(30(3,4)5)33-35(29(26)34)23-16-11-8-13-20(23)2/h8-11,13-16,27H,6-7,12,17-19H2,1-5H3,(H,32,36) |
| InChIKey | QTDUZUVISDNNMI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.17 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|