C26H28N4O3S — CID 42799625
1,3-benzodioxol-5-yl-[4-(2-cyclopropyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 42799625) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-(2-cyclopropyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-(2-cyclopropyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42799625 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-(2-cyclopropyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | CC1CCc2c(sc3nc(C4CC4)nc(N4CCN(C(=O)c5ccc6c(c5)OCO6)CC4)c23)C1 |
| InChI | InChI=1S/C26H28N4O3S/c1-15-2-6-18-21(12-15)34-25-22(18)24(27-23(28-25)16-3-4-16)29-8-10-30(11-9-29)26(31)17-5-7-19-20(13-17)33-14-32-19/h5,7,13,15-16H,2-4,6,8-12,14H2,1H3 |
| InChIKey | SRCWDLKRLYSROU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |