C23H27N3O7 — CID 42800263
methyl 1,3,5-trimethyl-4-[2-[(3-nitrobenzoyl)-(oxolan-2-ylmethyl)amino]acetyl]pyrrole-2-carboxylate (PubChem CID 42800263) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is methyl 1,3,5-trimethyl-4-[2-[(3-nitrobenzoyl)-(oxolan-2-ylmethyl)amino]acetyl]pyrrole-2-carboxylate.
| Compound Name | methyl 1,3,5-trimethyl-4-[2-[(3-nitrobenzoyl)-(oxolan-2-ylmethyl)amino]acetyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42800263 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | methyl 1,3,5-trimethyl-4-[2-[(3-nitrobenzoyl)-(oxolan-2-ylmethyl)amino]acetyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(C)c(C(=O)CN(CC2CCCO2)C(=O)c2cccc([N+](=O)[O-])c2)c(C)n1C |
| InChI | InChI=1S/C23H27N3O7/c1-14-20(15(2)24(3)21(14)23(29)32-4)19(27)13-25(12-18-9-6-10-33-18)22(28)16-7-5-8-17(11-16)26(30)31/h5,7-8,11,18H,6,9-10,12-13H2,1-4H3 |
| InChIKey | XZKPNTUIFNJJOW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 120.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|