C23H27ClN2O — CID 42802908
3-(4-chlorophenyl)-N-(3-methylbutan-2-yl)-3-(1-methylindol-3-yl)propanamide (PubChem CID 42802908) has the molecular formula C23H27ClN2O and a molecular weight of 382.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(3-methylbutan-2-yl)-3-(1-methylindol-3-yl)propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-(3-methylbutan-2-yl)-3-(1-methylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 42802908 |
| Molecular Formula | C23H27ClN2O |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(3-methylbutan-2-yl)-3-(1-methylindol-3-yl)propanamide |
| SMILES | CC(C)C(C)NC(=O)CC(c1ccc(Cl)cc1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C23H27ClN2O/c1-15(2)16(3)25-23(27)13-20(17-9-11-18(24)12-10-17)21-14-26(4)22-8-6-5-7-19(21)22/h5-12,14-16,20H,13H2,1-4H3,(H,25,27) |
| InChIKey | WSDWELIFRVPLOY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |