C21H23FN4O3 — CID 42803548
N-ethyl-3-(2-fluorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42803548) has the molecular formula C21H23FN4O3 and a molecular weight of 398.44 g/mol. Its IUPAC name is N-ethyl-3-(2-fluorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | N-ethyl-3-(2-fluorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42803548 |
| Molecular Formula | C21H23FN4O3 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-ethyl-3-(2-fluorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CCNC(=O)C1Cc2cc([N+](=O)[O-])ccc2N2CCN(c3ccccc3F)CC12 |
| InChI | InChI=1S/C21H23FN4O3/c1-2-23-21(27)16-12-14-11-15(26(28)29)7-8-18(14)25-10-9-24(13-20(16)25)19-6-4-3-5-17(19)22/h3-8,11,16,20H,2,9-10,12-13H2,1H3,(H,23,27) |
| InChIKey | TXAMCALOGRBDAM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|