C23H23F3N2O2 — CID 42804519
3-(1-methylindol-3-yl)-1-morpholin-4-yl-3-[2-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 42804519) has the molecular formula C23H23F3N2O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-1-morpholin-4-yl-3-[2-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 3-(1-methylindol-3-yl)-1-morpholin-4-yl-3-[2-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 42804519 |
| Molecular Formula | C23H23F3N2O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-(1-methylindol-3-yl)-1-morpholin-4-yl-3-[2-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | Cn1cc(C(CC(=O)N2CCOCC2)c2ccccc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C23H23F3N2O2/c1-27-15-19(17-7-3-5-9-21(17)27)18(14-22(29)28-10-12-30-13-11-28)16-6-2-4-8-20(16)23(24,25)26/h2-9,15,18H,10-14H2,1H3 |
| InChIKey | FJIFCUUCESEORP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |