C29H27F2N5O3 — CID 42806443
N-ethyl-N-[[1-(3-fluorophenyl)-5-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]methyl]-3-nitrobenzamide (PubChem CID 42806443) has the molecular formula C29H27F2N5O3 and a molecular weight of 531.56 g/mol. Its IUPAC name is N-ethyl-N-[[1-(3-fluorophenyl)-5-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]methyl]-3-nitrobenzamide.
| Compound Name | N-ethyl-N-[[1-(3-fluorophenyl)-5-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42806443 |
| Molecular Formula | C29H27F2N5O3 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | N-ethyl-N-[[1-(3-fluorophenyl)-5-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]methyl]-3-nitrobenzamide |
| SMILES | CCN(Cc1nn(-c2cccc(F)c2)c2c1CN(Cc1ccccc1F)CC2)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27F2N5O3/c1-2-34(29(37)20-8-5-11-24(15-20)36(38)39)19-27-25-18-33(17-21-7-3-4-12-26(21)31)14-13-28(25)35(32-27)23-10-6-9-22(30)16-23/h3-12,15-16H,2,13-14,17-19H2,1H3 |
| InChIKey | ZHDJRQBSTFXDJU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|