C7H6F9NO — CID 4280657
N-ethyl-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 4280657) has the molecular formula C7H6F9NO and a molecular weight of 291.11 g/mol. Its IUPAC name is N-ethyl-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-ethyl-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 4280657 |
| Molecular Formula | C7H6F9NO |
| Molecular Weight | 291.11 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | N-ethyl-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | CCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F9NO/c1-2-17-3(18)4(8,9)5(10,11)6(12,13)7(14,15)16/h2H2,1H3,(H,17,18) |
| InChIKey | BPUDDBGLNYFQPY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|